C52H64O10 — CID 88894152
[2-[3-methyl-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]-3-methylbenzoate (PubChem CID 88894152) has the molecular formula C52H64O10 and a molecular weight of 849.07 g/mol. Its IUPAC name is [2-[3-methyl-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]-3-methylbenzoate.
| Compound Name | [2-[3-methyl-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]-3-methylbenzoate |
|---|---|
| PubChem CID | 88894152 |
| Molecular Formula | C52H64O10 |
| Molecular Weight | 849.07 g/mol |
| Exact Mass | 848.45 |
| IUPAC Name | [2-[3-methyl-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]-3-methylbenzoate |
| SMILES | CCCC(OCC1CCC(O)CC1)Oc1ccc(C(=O)OC(c2ccccc2)C(OC(=O)c2ccc(OC(CCC)OCC3CCC4OC4C3)c(C)c2)c2ccccc2)cc1C |
| InChI | InChI=1S/C52H64O10/c1-5-13-47(56-32-36-19-24-42(53)25-20-36)59-43-27-22-40(29-34(43)3)51(54)61-49(38-15-9-7-10-16-38)50(39-17-11-8-12-18-39)62-52(55)41-23-28-44(35(4)30-41)60-48(14-6-2)57-33-37-21-26-45-46(31-37)58-45/h7-12,15-18,22-23,27-30,36-37,42,45-50,53H,5-6,13-14,19-21,24-26,31-33H2,1-4H3 |
| InChIKey | NYHOKRDVYCLAOF-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.07 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|