C15H15F9O2 — CID 88894461
2,2,3,3,6,6,7,7,7-nonafluoroheptyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 88894461) has the molecular formula C15H15F9O2 and a molecular weight of 398.27 g/mol. Its IUPAC name is 2,2,3,3,6,6,7,7,7-nonafluoroheptyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,3,3,6,6,7,7,7-nonafluoroheptyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 88894461 |
| Molecular Formula | C15H15F9O2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2,2,3,3,6,6,7,7,7-nonafluoroheptyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C15H15F9O2/c16-12(17,3-4-13(18,19)15(22,23)24)14(20,21)7-26-11(25)10-6-8-1-2-9(10)5-8/h1-2,8-10H,3-7H2 |
| InChIKey | WECHFKYQZQBALC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|