C18H21F9O2 — CID 88894463
3,3,6,6,7,7,10,10,10-nonafluorodecyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 88894463) has the molecular formula C18H21F9O2 and a molecular weight of 440.35 g/mol. Its IUPAC name is 3,3,6,6,7,7,10,10,10-nonafluorodecyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 3,3,6,6,7,7,10,10,10-nonafluorodecyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 88894463 |
| Molecular Formula | C18H21F9O2 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3,3,6,6,7,7,10,10,10-nonafluorodecyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCCC(F)(F)CCC(F)(F)C(F)(F)CCC(F)(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C18H21F9O2/c19-15(20,3-4-16(21,22)17(23,24)5-6-18(25,26)27)7-8-29-14(28)13-10-11-1-2-12(13)9-11/h1-2,11-13H,3-10H2 |
| InChIKey | HXYHWUSHGNVATN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|