C12H14F4 — CID 88894469
2-(4,4,5,5-tetrafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 88894469) has the molecular formula C12H14F4 and a molecular weight of 234.24 g/mol. Its IUPAC name is 2-(4,4,5,5-tetrafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-(4,4,5,5-tetrafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 88894469 |
| Molecular Formula | C12H14F4 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-(4,4,5,5-tetrafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)C(F)(F)CCCC1=CC2C=CC1C2 |
| InChI | InChI=1S/C12H14F4/c13-11(14)12(15,16)5-1-2-9-6-8-3-4-10(9)7-8/h3-4,6,8,10-11H,1-2,5,7H2 |
| InChIKey | FKUNVWNDJQMYNU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|