C16H18F8 — CID 88894476
2-(4,4,5,5,8,8,9,9-octafluorononyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 88894476) has the molecular formula C16H18F8 and a molecular weight of 362.30 g/mol. Its IUPAC name is 2-(4,4,5,5,8,8,9,9-octafluorononyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-(4,4,5,5,8,8,9,9-octafluorononyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 88894476 |
| Molecular Formula | C16H18F8 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(4,4,5,5,8,8,9,9-octafluorononyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)C(F)(F)CCC(F)(F)C(F)(F)CCCC1=CC2C=CC1C2 |
| InChI | InChI=1S/C16H18F8/c17-13(18)14(19,20)6-7-16(23,24)15(21,22)5-1-2-11-8-10-3-4-12(11)9-10/h3-4,8,10,12-13H,1-2,5-7,9H2 |
| InChIKey | LTAHNQBEVJPPFZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|