C18H20ClN5OS — CID 88894530
N-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 88894530) has the molecular formula C18H20ClN5OS and a molecular weight of 389.91 g/mol. Its IUPAC name is N-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 88894530 |
| Molecular Formula | C18H20ClN5OS |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | C=C/C(Cl)=C(\C=C)NC(=O)CSc1nnnn1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H20ClN5OS/c1-6-14(19)15(7-2)20-16(25)10-26-18-21-22-23-24(18)17-12(4)8-11(3)9-13(17)5/h6-9H,1-2,10H2,3-5H3,(H,20,25)/b15-14- |
| InChIKey | UIGVFPDYKPMMFO-PFONDFGASA-N |
| XLogP | 3.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|