C13H16F9NO2S — CID 88895269
N-[2,2-bis(difluoromethyl)-1,1,3,3,3-pentafluoropropyl]-2,5-dimethylhexa-2,4-diene-3-sulfonamide (PubChem CID 88895269) has the molecular formula C13H16F9NO2S and a molecular weight of 421.33 g/mol. Its IUPAC name is N-[2,2-bis(difluoromethyl)-1,1,3,3,3-pentafluoropropyl]-2,5-dimethylhexa-2,4-diene-3-sulfonamide.
| Compound Name | N-[2,2-bis(difluoromethyl)-1,1,3,3,3-pentafluoropropyl]-2,5-dimethylhexa-2,4-diene-3-sulfonamide |
|---|---|
| PubChem CID | 88895269 |
| Molecular Formula | C13H16F9NO2S |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[2,2-bis(difluoromethyl)-1,1,3,3,3-pentafluoropropyl]-2,5-dimethylhexa-2,4-diene-3-sulfonamide |
| SMILES | CC(C)=CC(=C(C)C)S(=O)(=O)NC(F)(F)C(C(F)F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H16F9NO2S/c1-6(2)5-8(7(3)4)26(24,25)23-13(21,22)11(9(14)15,10(16)17)12(18,19)20/h5,9-10,23H,1-4H3 |
| InChIKey | OQEKXUXANLXZQO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|