C22H20N2O4S4 — CID 88895791
2-[2-(1-cyano-3,3-dimethyl-2-oxobutylidene)-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 88895791) has the molecular formula C22H20N2O4S4 and a molecular weight of 504.68 g/mol. Its IUPAC name is 2-[2-(1-cyano-3,3-dimethyl-2-oxobutylidene)-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-[2-(1-cyano-3,3-dimethyl-2-oxobutylidene)-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 88895791 |
| Molecular Formula | C22H20N2O4S4 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 2-[2-(1-cyano-3,3-dimethyl-2-oxobutylidene)-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)=C1Sc2c(O)c3c(c(O)c2S1)SC(=C(C#N)C(=O)C(C)(C)C)S3 |
| InChI | InChI=1S/C22H20N2O4S4/c1-21(2,3)17(27)9(7-23)19-29-13-11(25)15-16(12(26)14(13)30-19)32-20(31-15)10(8-24)18(28)22(4,5)6/h25-26H,1-6H3/b19-9-,20-10+ |
| InChIKey | IBUQRHLXKMVFLD-KFSYKRRRSA-N |
| XLogP | 6.19 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|