C11H14F7NO2S — CID 88895855
(2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,4,4,4-heptafluorobutylamino)propanoic acid (PubChem CID 88895855) has the molecular formula C11H14F7NO2S and a molecular weight of 357.29 g/mol. Its IUPAC name is (2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,4,4,4-heptafluorobutylamino)propanoic acid.
| Compound Name | (2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,4,4,4-heptafluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 88895855 |
| Molecular Formula | C11H14F7NO2S |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,4,4,4-heptafluorobutylamino)propanoic acid |
| SMILES | O=C(O)[C@H](CSCC1CC1)NCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F7NO2S/c12-9(13,10(14,15)11(16,17)18)5-19-7(8(20)21)4-22-3-6-1-2-6/h6-7,19H,1-5H2,(H,20,21)/t7-/m0/s1 |
| InChIKey | BXCANDUUBBHRCA-ZETCQYMHSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|