C15H17N3O2S — CID 8889608
(2R)-2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 8889608) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (2R)-2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 8889608 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R)-2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)Sc1nnc(-c2cccc(C)c2)o1 |
| InChI | InChI=1S/C15H17N3O2S/c1-4-8-16-13(19)11(3)21-15-18-17-14(20-15)12-7-5-6-10(2)9-12/h4-7,9,11H,1,8H2,2-3H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | NSXKQXCSEXNZGN-LLVKDONJSA-N |
| XLogP | 2.83 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|