C16H10F16 — CID 88896279
2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 88896279) has the molecular formula C16H10F16 and a molecular weight of 506.22 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 88896279 |
| Molecular Formula | C16H10F16 |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1=CC2C=CC1C2 |
| InChI | InChI=1S/C16H10F16/c17-9(18)11(21,22)13(25,26)15(29,30)16(31,32)14(27,28)12(23,24)10(19,20)5-8-4-6-1-2-7(8)3-6/h1-2,4,6-7,9H,3,5H2 |
| InChIKey | ZPZFTKYHWMTINF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|