C14H11F9O2 — CID 88896341
3,3,4,4,5,5,6,6,6-nonafluorohexyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 88896341) has the molecular formula C14H11F9O2 and a molecular weight of 382.22 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 88896341 |
| Molecular Formula | C14H11F9O2 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C14H11F9O2/c15-11(16,12(17,18)13(19,20)14(21,22)23)3-4-25-10(24)9-6-7-1-2-8(9)5-7/h1-2,6-8H,3-5H2 |
| InChIKey | FLTIXPYTAHXCIW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|