C12H10F8 — CID 88896348
2-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 88896348) has the molecular formula C12H10F8 and a molecular weight of 306.20 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 88896348 |
| Molecular Formula | C12H10F8 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CC1=CC2C=CC1C2 |
| InChI | InChI=1S/C12H10F8/c13-9(14)11(17,18)12(19,20)10(15,16)5-8-4-6-1-2-7(8)3-6/h1-2,4,6-7,9H,3,5H2 |
| InChIKey | MPRIOKSWSNIPQZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|