About 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde
4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde (PubChem CID 88896393) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde |
| PubChem CID | 88896393 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde |
| SMILES | COC1CC(CO)C(C=O)C(OC)C1C=O |
| InChI | InChI=1S/C11H18O5/c1-15-10-3-7(4-12)8(5-13)11(16-2)9(10)6-14/h5-12H,3-4H2,1-2H3 |
| InChIKey | YARUASYAPNOMLJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde?
The IUPAC name of 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde (CID 88896393) is 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde.
What is the SMILES notation for 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde?
The canonical SMILES for 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde is COC1CC(CO)C(C=O)C(OC)C1C=O.
What is the InChIKey of 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde?
The InChIKey is YARUASYAPNOMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5/c1-15-10-3-7(4-12)8(5-13)11(16-2)9(10)6-14/h5-12H,3-4H2,1-2H3.
What are the key properties of 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde?
4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde has a molecular weight of 230.26 g/mol, XLogP of -0.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,6-dimethoxycyclohexane-1,3-dicarbaldehyde is sourced from PubChem (CID 88896393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).