C48H27F6N5S — CID 88896510
2-[3-benzo[h]quinolin-5-yl-5-[3-[5-[3,5-bis(trifluoromethyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole (PubChem CID 88896510) has the molecular formula C48H27F6N5S and a molecular weight of 819.83 g/mol. Its IUPAC name is 2-[3-benzo[h]quinolin-5-yl-5-[3-[5-[3,5-bis(trifluoromethyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-benzo[h]quinolin-5-yl-5-[3-[5-[3,5-bis(trifluoromethyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 88896510 |
| Molecular Formula | C48H27F6N5S |
| Molecular Weight | 819.83 g/mol |
| Exact Mass | 819.19 |
| IUPAC Name | 2-[3-benzo[h]quinolin-5-yl-5-[3-[5-[3,5-bis(trifluoromethyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole |
| SMILES | FC(F)(F)c1cc(-c2nnc(-c3cccc(-c4cc(-c5nc6ccccc6s5)cc(-c5cc6ccccc6c6ncccc56)c4)c3)n2-c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C48H27F6N5S/c49-47(50,51)35-24-33(25-36(27-35)48(52,53)54)45-58-57-44(59(45)37-13-2-1-3-14-37)30-12-8-11-28(20-30)31-21-32(23-34(22-31)46-56-41-17-6-7-18-42(41)60-46)40-26-29-10-4-5-15-38(29)43-39(40)16-9-19-55-43/h1-27H |
| InChIKey | VETQOPHBGUNSMR-UHFFFAOYSA-N |
| XLogP | 13.95 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.83 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|