C21H21N5O4 — CID 88896655
4-[8-(3,4-dimethoxyphenyl)-7-methyl-2,6-dioxo-1-prop-2-ynylpurin-3-yl]butanenitrile (PubChem CID 88896655) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-[8-(3,4-dimethoxyphenyl)-7-methyl-2,6-dioxo-1-prop-2-ynylpurin-3-yl]butanenitrile.
| Compound Name | 4-[8-(3,4-dimethoxyphenyl)-7-methyl-2,6-dioxo-1-prop-2-ynylpurin-3-yl]butanenitrile |
|---|---|
| PubChem CID | 88896655 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[8-(3,4-dimethoxyphenyl)-7-methyl-2,6-dioxo-1-prop-2-ynylpurin-3-yl]butanenitrile |
| SMILES | C#CCn1c(=O)c2c(nc(-c3ccc(OC)c(OC)c3)n2C)n(CCCC#N)c1=O |
| InChI | InChI=1S/C21H21N5O4/c1-5-11-26-20(27)17-19(25(21(26)28)12-7-6-10-22)23-18(24(17)2)14-8-9-15(29-3)16(13-14)30-4/h1,8-9,13H,6-7,11-12H2,2-4H3 |
| InChIKey | MTWQQWCBTROTOA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|