About [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane
[2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane (PubChem CID 88897094) has the molecular formula C10H9BFNOS
and a molecular weight of 221.07 g/mol. Its IUPAC name is [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane.
Molecular Properties
| Compound Name | [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane |
| PubChem CID | 88897094 |
| Molecular Formula | C10H9BFNOS |
| Molecular Weight | 221.07 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane |
| SMILES | Bc1ccc(OCc2cncs2)cc1F |
| InChI | InChI=1S/C10H9BFNOS/c11-9-2-1-7(3-10(9)12)14-5-8-4-13-6-15-8/h1-4,6H,5,11H2 |
| InChIKey | VQFPURGHOGUCIM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.07 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane?
The IUPAC name of [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane (CID 88897094) is [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane.
What is the SMILES notation for [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane?
The canonical SMILES for [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane is Bc1ccc(OCc2cncs2)cc1F.
What is the InChIKey of [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane?
The InChIKey is VQFPURGHOGUCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BFNOS/c11-9-2-1-7(3-10(9)12)14-5-8-4-13-6-15-8/h1-4,6H,5,11H2.
What are the key properties of [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane?
[2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane has a molecular weight of 221.07 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]borane is sourced from PubChem (CID 88897094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).