C27H50N4O9 — CID 88897243
methyl (2S)-6-[[(2R)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 88897243) has the molecular formula C27H50N4O9 and a molecular weight of 574.72 g/mol. Its IUPAC name is methyl (2S)-6-[[(2R)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-[[(2R)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 88897243 |
| Molecular Formula | C27H50N4O9 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | methyl (2S)-6-[[(2R)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)[C@@H](CCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H50N4O9/c1-25(2,3)38-22(34)29-17-13-15-18(30-23(35)39-26(4,5)6)20(32)28-16-12-11-14-19(21(33)37-10)31-24(36)40-27(7,8)9/h18-19H,11-17H2,1-10H3,(H,28,32)(H,29,34)(H,30,35)(H,31,36)/t18-,19+/m1/s1 |
| InChIKey | KNEXZQGSHHGHLS-MOPGFXCFSA-N |
| XLogP | 3.54 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|