About (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile
(E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile (PubChem CID 88897301) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile.
Molecular Properties
| Compound Name | (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile |
| PubChem CID | 88897301 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile |
| SMILES | C/C=C/C(C#N)=C/[C@@H]1CC1(C)C |
| InChI | InChI=1S/C11H15N/c1-4-5-9(8-12)6-10-7-11(10,2)3/h4-6,10H,7H2,1-3H3/b5-4+,9-6-/t10-/m1/s1 |
| InChIKey | FDJLLWRWUFRSSL-JJHXLEJMSA-N |
| XLogP | 3.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile?
The IUPAC name of (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile (CID 88897301) is (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile.
What is the SMILES notation for (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile?
The canonical SMILES for (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile is C/C=C/C(C#N)=C/[C@@H]1CC1(C)C.
What is the InChIKey of (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile?
The InChIKey is FDJLLWRWUFRSSL-JJHXLEJMSA-N. The full InChI is InChI=1S/C11H15N/c1-4-5-9(8-12)6-10-7-11(10,2)3/h4-6,10H,7H2,1-3H3/b5-4+,9-6-/t10-/m1/s1.
What are the key properties of (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile?
(E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile has a molecular weight of 161.25 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2Z)-2-[[(1S)-2,2-dimethylcyclopropyl]methylidene]pent-3-enenitrile is sourced from PubChem (CID 88897301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).