C25H21N3O8S — CID 88897947
3-[(1R)-1-carboxy-1-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-3-methylthiophene-2-carbonyl]amino]-2-isocyanatoethyl]benzoic acid (PubChem CID 88897947) has the molecular formula C25H21N3O8S and a molecular weight of 523.52 g/mol. Its IUPAC name is 3-[(1R)-1-carboxy-1-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-3-methylthiophene-2-carbonyl]amino]-2-isocyanatoethyl]benzoic acid.
| Compound Name | 3-[(1R)-1-carboxy-1-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-3-methylthiophene-2-carbonyl]amino]-2-isocyanatoethyl]benzoic acid |
|---|---|
| PubChem CID | 88897947 |
| Molecular Formula | C25H21N3O8S |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 3-[(1R)-1-carboxy-1-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-3-methylthiophene-2-carbonyl]amino]-2-isocyanatoethyl]benzoic acid |
| SMILES | Cc1cc(C(=O)NCc2cccc(O)c2)sc1C(=O)N[C@](CN=C=O)(C(=O)O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H21N3O8S/c1-14-8-19(21(31)27-11-15-4-2-7-18(30)9-15)37-20(14)22(32)28-25(24(35)36,12-26-13-29)17-6-3-5-16(10-17)23(33)34/h2-10,30H,11-12H2,1H3,(H,27,31)(H,28,32)(H,33,34)(H,35,36)/t25-/m0/s1 |
| InChIKey | WUUHYRZLVYARPL-VWLOTQADSA-N |
| XLogP | 2.44 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|