C20H22F3N3O2S — CID 88898014
(5R)-6,6-difluoro-5-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 88898014) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is (5R)-6,6-difluoro-5-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | (5R)-6,6-difluoro-5-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 88898014 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (5R)-6,6-difluoro-5-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | COc1ccc(Nc2ccc(F)c([C@@]3(C)NC(=S)COC(C)(C)C3(F)F)c2)cn1 |
| InChI | InChI=1S/C20H22F3N3O2S/c1-18(2)20(22,23)19(3,26-17(29)11-28-18)14-9-12(5-7-15(14)21)25-13-6-8-16(27-4)24-10-13/h5-10,25H,11H2,1-4H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | QBBLLWLRHBKCMT-LJQANCHMSA-N |
| XLogP | 4.55 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|