About ethanesulfonic acid;2-methylpropane-2-sulfonic acid
ethanesulfonic acid;2-methylpropane-2-sulfonic acid (PubChem CID 88898016) has the molecular formula C6H16O6S2
and a molecular weight of 248.32 g/mol. Its IUPAC name is ethanesulfonic acid;2-methylpropane-2-sulfonic acid.
Molecular Properties
| Compound Name | ethanesulfonic acid;2-methylpropane-2-sulfonic acid |
| PubChem CID | 88898016 |
| Molecular Formula | C6H16O6S2 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | ethanesulfonic acid;2-methylpropane-2-sulfonic acid |
| SMILES | CC(C)(C)S(=O)(=O)O.CCS(=O)(=O)O |
| InChI | InChI=1S/C4H10O3S.C2H6O3S/c1-4(2,3)8(5,6)7;1-2-6(3,4)5/h1-3H3,(H,5,6,7);2H2,1H3,(H,3,4,5) |
| InChIKey | PERSMULDVKVIQH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethanesulfonic acid;2-methylpropane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanesulfonic acid;2-methylpropane-2-sulfonic acid?
The IUPAC name of ethanesulfonic acid;2-methylpropane-2-sulfonic acid (CID 88898016) is ethanesulfonic acid;2-methylpropane-2-sulfonic acid.
What is the SMILES notation for ethanesulfonic acid;2-methylpropane-2-sulfonic acid?
The canonical SMILES for ethanesulfonic acid;2-methylpropane-2-sulfonic acid is CC(C)(C)S(=O)(=O)O.CCS(=O)(=O)O.
What is the InChIKey of ethanesulfonic acid;2-methylpropane-2-sulfonic acid?
The InChIKey is PERSMULDVKVIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3S.C2H6O3S/c1-4(2,3)8(5,6)7;1-2-6(3,4)5/h1-3H3,(H,5,6,7);2H2,1H3,(H,3,4,5).
What are the key properties of ethanesulfonic acid;2-methylpropane-2-sulfonic acid?
ethanesulfonic acid;2-methylpropane-2-sulfonic acid has a molecular weight of 248.32 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanesulfonic acid;2-methylpropane-2-sulfonic acid is sourced from PubChem (CID 88898016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).