C19H19F4N3OS — CID 88898050
(5R)-6,6-difluoro-5-[2-fluoro-5-[(5-fluoro-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 88898050) has the molecular formula C19H19F4N3OS and a molecular weight of 413.44 g/mol. Its IUPAC name is (5R)-6,6-difluoro-5-[2-fluoro-5-[(5-fluoro-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | (5R)-6,6-difluoro-5-[2-fluoro-5-[(5-fluoro-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 88898050 |
| Molecular Formula | C19H19F4N3OS |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (5R)-6,6-difluoro-5-[2-fluoro-5-[(5-fluoro-3-pyridinyl)amino]phenyl]-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | CC1(C)OCC(=S)N[C@](C)(c2cc(Nc3cncc(F)c3)ccc2F)C1(F)F |
| InChI | InChI=1S/C19H19F4N3OS/c1-17(2)19(22,23)18(3,26-16(28)10-27-17)14-7-12(4-5-15(14)21)25-13-6-11(20)8-24-9-13/h4-9,25H,10H2,1-3H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | NICKLLBJVMPBFG-GOSISDBHSA-N |
| XLogP | 4.68 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|