C22H7F15N2O4 — CID 88898104
13-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone (PubChem CID 88898104) has the molecular formula C22H7F15N2O4 and a molecular weight of 648.28 g/mol. Its IUPAC name is 13-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone.
| Compound Name | 13-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 88898104 |
| Molecular Formula | C22H7F15N2O4 |
| Molecular Weight | 648.28 g/mol |
| Exact Mass | 648.02 |
| IUPAC Name | 13-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
| SMILES | O=c1[nH]c(=O)c2ccc1c1c3cc(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(c(=O)[nH]c3=O)c21 |
| InChI | InChI=1S/C22H7F15N2O4/c23-16(24,17(25,26)18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)37)4-5-3-8-10-6-1-2-7(13(41)38-12(6)40)11(10)9(5)15(43)39-14(8)42/h1-3H,4H2,(H,38,40,41)(H,39,42,43) |
| InChIKey | FXFSLRQHUNPXBB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.28 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|