C21H30F8N2O4 — CID 88898555
2,2,3,3-tetrafluoropropyl N-[4-[[4-(2,2,3,3-tetrafluoropropoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate (PubChem CID 88898555) has the molecular formula C21H30F8N2O4 and a molecular weight of 526.47 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl N-[4-[[4-(2,2,3,3-tetrafluoropropoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate.
| Compound Name | 2,2,3,3-tetrafluoropropyl N-[4-[[4-(2,2,3,3-tetrafluoropropoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 88898555 |
| Molecular Formula | C21H30F8N2O4 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl N-[4-[[4-(2,2,3,3-tetrafluoropropoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(CC2CCC(NC(=O)OCC(F)(F)C(F)F)CC2)CC1)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C21H30F8N2O4/c22-16(23)20(26,27)10-34-18(32)30-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)31-19(33)35-11-21(28,29)17(24)25/h12-17H,1-11H2,(H,30,32)(H,31,33) |
| InChIKey | GGKJNDIVRBJJDP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|