C25H30F16N2O4 — CID 88898608
2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate (PubChem CID 88898608) has the molecular formula C25H30F16N2O4 and a molecular weight of 726.49 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 88898608 |
| Molecular Formula | C25H30F16N2O4 |
| Molecular Weight | 726.49 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(CC2CCC(NC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC2)CC1)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C25H30F16N2O4/c26-16(27)22(34,35)24(38,39)20(30,31)10-46-18(44)42-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)43-19(45)47-11-21(32,33)25(40,41)23(36,37)17(28)29/h12-17H,1-11H2,(H,42,44)(H,43,45) |
| InChIKey | QGCHHXNJHIQLAY-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.49 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|