About (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol
(4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol (PubChem CID 88898684) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol.
Molecular Properties
| Compound Name | (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol |
| PubChem CID | 88898684 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol |
| SMILES | C=C/C=C(\C)C(OCCN(C)C)C(=C)O |
| InChI | InChI=1S/C12H21NO2/c1-6-7-10(2)12(11(3)14)15-9-8-13(4)5/h6-7,12,14H,1,3,8-9H2,2,4-5H3/b10-7+ |
| InChIKey | XYSMYGHSQCUEPN-JXMROGBWSA-N |
| XLogP | 2.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol?
The IUPAC name of (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol (CID 88898684) is (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol.
What is the SMILES notation for (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol?
The canonical SMILES for (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol is C=C/C=C(\C)C(OCCN(C)C)C(=C)O.
What is the InChIKey of (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol?
The InChIKey is XYSMYGHSQCUEPN-JXMROGBWSA-N. The full InChI is InChI=1S/C12H21NO2/c1-6-7-10(2)12(11(3)14)15-9-8-13(4)5/h6-7,12,14H,1,3,8-9H2,2,4-5H3/b10-7+.
What are the key properties of (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol?
(4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol has a molecular weight of 211.30 g/mol, XLogP of 2.14, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3-[2-(dimethylamino)ethoxy]-4-methylhepta-1,4,6-trien-2-ol is sourced from PubChem (CID 88898684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).