About cyclooct-4-yn-1-yl 4-oxobutanoate
cyclooct-4-yn-1-yl 4-oxobutanoate (PubChem CID 88899017) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is cyclooct-4-yn-1-yl 4-oxobutanoate.
Molecular Properties
| Compound Name | cyclooct-4-yn-1-yl 4-oxobutanoate |
| PubChem CID | 88899017 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | cyclooct-4-yn-1-yl 4-oxobutanoate |
| SMILES | O=CCCC(=O)OC1CCC#CCCC1 |
| InChI | InChI=1S/C12H16O3/c13-10-6-9-12(14)15-11-7-4-2-1-3-5-8-11/h10-11H,2,4-9H2 |
| InChIKey | XQWVAVPPWVGCMZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclooct-4-yn-1-yl 4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooct-4-yn-1-yl 4-oxobutanoate?
The IUPAC name of cyclooct-4-yn-1-yl 4-oxobutanoate (CID 88899017) is cyclooct-4-yn-1-yl 4-oxobutanoate.
What is the SMILES notation for cyclooct-4-yn-1-yl 4-oxobutanoate?
The canonical SMILES for cyclooct-4-yn-1-yl 4-oxobutanoate is O=CCCC(=O)OC1CCC#CCCC1.
What is the InChIKey of cyclooct-4-yn-1-yl 4-oxobutanoate?
The InChIKey is XQWVAVPPWVGCMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c13-10-6-9-12(14)15-11-7-4-2-1-3-5-8-11/h10-11H,2,4-9H2.
What are the key properties of cyclooct-4-yn-1-yl 4-oxobutanoate?
cyclooct-4-yn-1-yl 4-oxobutanoate has a molecular weight of 208.26 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooct-4-yn-1-yl 4-oxobutanoate is sourced from PubChem (CID 88899017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).