About CID 88899203
CID 88899203 (PubChem CID 88899203) has the molecular formula C7H6BNO
and a molecular weight of 130.94 g/mol.
Molecular Properties
| Compound Name | CID 88899203 |
| PubChem CID | 88899203 |
| Molecular Formula | C7H6BNO |
| Molecular Weight | 130.94 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CC=O)cn1 |
| InChI | InChI=1S/C7H6BNO/c8-7-2-1-6(3-4-10)5-9-7/h1-2,4-5H,3H2 |
| InChIKey | MSMJZDCQRWNKQJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.94 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88899203 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88899203?
The IUPAC name of CID 88899203 (CID 88899203) is not available.
What is the SMILES notation for CID 88899203?
The canonical SMILES for CID 88899203 is [B]c1ccc(CC=O)cn1.
What is the InChIKey of CID 88899203?
The InChIKey is MSMJZDCQRWNKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BNO/c8-7-2-1-6(3-4-10)5-9-7/h1-2,4-5H,3H2.
What are the key properties of CID 88899203?
CID 88899203 has a molecular weight of 130.94 g/mol, XLogP of -0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88899203 is sourced from PubChem (CID 88899203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).