C19H31P — CID 88899429
dicyclohexyl-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phosphane (PubChem CID 88899429) has the molecular formula C19H31P and a molecular weight of 290.43 g/mol. Its IUPAC name is dicyclohexyl-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phosphane.
| Compound Name | dicyclohexyl-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phosphane |
|---|---|
| PubChem CID | 88899429 |
| Molecular Formula | C19H31P |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | dicyclohexyl-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phosphane |
| SMILES | C=C/C=C\C=C(/C)P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H31P/c1-3-4-7-12-17(2)20(18-13-8-5-9-14-18)19-15-10-6-11-16-19/h3-4,7,12,18-19H,1,5-6,8-11,13-16H2,2H3/b7-4-,17-12+ |
| InChIKey | VSEOMVHLXKXMTN-LUJAEEAZSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|