C12H9F2IO3 — CID 88899532
1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-iodoethanone (PubChem CID 88899532) has the molecular formula C12H9F2IO3 and a molecular weight of 366.10 g/mol. Its IUPAC name is 1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-iodoethanone.
| Compound Name | 1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-iodoethanone |
|---|---|
| PubChem CID | 88899532 |
| Molecular Formula | C12H9F2IO3 |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-iodoethanone |
| SMILES | O=C(CI)C1(c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C12H9F2IO3/c13-12(14)17-8-2-1-7(5-9(8)18-12)11(3-4-11)10(16)6-15/h1-2,5H,3-4,6H2 |
| InChIKey | GUSGESARNKWPSB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|