About methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate
methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate (PubChem CID 88899592) has the molecular formula C22H20N4O4
and a molecular weight of 404.43 g/mol. Its IUPAC name is methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate.
Molecular Properties
| Compound Name | methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate |
| PubChem CID | 88899592 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1C)nc1c(=O)[nH]c(=O)nc-1n2CCCc1ccccc1 |
| InChI | InChI=1S/C22H20N4O4/c1-13-11-16-17(12-15(13)21(28)30-2)26(10-6-9-14-7-4-3-5-8-14)19-18(23-16)20(27)25-22(29)24-19/h3-5,7-8,11-12H,6,9-10H2,1-2H3,(H,25,27,29) |
| InChIKey | XIHFDCYZCSQELU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate?
The IUPAC name of methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate (CID 88899592) is methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate.
What is the SMILES notation for methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate?
The canonical SMILES for methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate is COC(=O)c1cc2c(cc1C)nc1c(=O)[nH]c(=O)nc-1n2CCCc1ccccc1.
What is the InChIKey of methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate?
The InChIKey is XIHFDCYZCSQELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O4/c1-13-11-16-17(12-15(13)21(28)30-2)26(10-6-9-14-7-4-3-5-8-14)19-18(23-16)20(27)25-22(29)24-19/h3-5,7-8,11-12H,6,9-10H2,1-2H3,(H,25,27,29).
What are the key properties of methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate?
methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate has a molecular weight of 404.43 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-methyl-2,4-dioxo-10-(3-phenylpropyl)benzo[g]pteridine-8-carboxylate is sourced from PubChem (CID 88899592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).