C26H31N5O3 — CID 88899652
10-[3-[4-(3-amino-3-methylbutoxy)phenyl]propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 88899652) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 10-[3-[4-(3-amino-3-methylbutoxy)phenyl]propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[3-[4-(3-amino-3-methylbutoxy)phenyl]propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 88899652 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 10-[3-[4-(3-amino-3-methylbutoxy)phenyl]propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCc3ccc(OCCC(C)(C)N)cc3)c2cc1C |
| InChI | InChI=1S/C26H31N5O3/c1-16-14-20-21(15-17(16)2)31(23-22(28-20)24(32)30-25(33)29-23)12-5-6-18-7-9-19(10-8-18)34-13-11-26(3,4)27/h7-10,14-15H,5-6,11-13,27H2,1-4H3,(H,30,32,33) |
| InChIKey | WCRJEBLJRAIFLO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|