About 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane
5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane (PubChem CID 88900049) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane |
| PubChem CID | 88900049 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane |
| SMILES | [C-]#[N+]C1CC2CC1CC2(C)C |
| InChI | InChI=1S/C10H15N/c1-10(2)6-7-4-8(10)5-9(7)11-3/h7-9H,4-6H2,1-2H3 |
| InChIKey | WZFSFEZXPZLRGB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane?
The IUPAC name of 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane (CID 88900049) is 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane.
What is the SMILES notation for 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane?
The canonical SMILES for 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane is [C-]#[N+]C1CC2CC1CC2(C)C.
What is the InChIKey of 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane?
The InChIKey is WZFSFEZXPZLRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-10(2)6-7-4-8(10)5-9(7)11-3/h7-9H,4-6H2,1-2H3.
What are the key properties of 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane?
5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane has a molecular weight of 149.24 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyano-2,2-dimethylbicyclo[2.2.1]heptane is sourced from PubChem (CID 88900049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).