C8H13IN2 — CID 88900185
(1E,3Z)-N,4-dimethyl-5-[(methylideneamino)-λ3-iodanylidene]penta-1,3-dien-1-amine (PubChem CID 88900185) has the molecular formula C8H13IN2 and a molecular weight of 264.11 g/mol. Its IUPAC name is (1E,3Z)-N,4-dimethyl-5-[(methylideneamino)-λ3-iodanylidene]penta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-N,4-dimethyl-5-[(methylideneamino)-λ3-iodanylidene]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88900185 |
| Molecular Formula | C8H13IN2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (1E,3Z)-N,4-dimethyl-5-[(methylideneamino)-λ3-iodanylidene]penta-1,3-dien-1-amine |
| SMILES | C=N/I=C/C(C)=C\C=C\NC |
| InChI | InChI=1S/C8H13IN2/c1-8(7-9-11-3)5-4-6-10-2/h4-7,10H,3H2,1-2H3/b6-4+,8-5- |
| InChIKey | OLKZXFJLDRZJCC-NDWVUGOJSA-N |
| XLogP | 2.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|