C9H16O — CID 88900197
(3R,4E)-3,4-dimethylhepta-4,6-dien-1-ol (PubChem CID 88900197) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3R,4E)-3,4-dimethylhepta-4,6-dien-1-ol.
| Compound Name | (3R,4E)-3,4-dimethylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 88900197 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3R,4E)-3,4-dimethylhepta-4,6-dien-1-ol |
| SMILES | C=C/C=C(\C)[C@H](C)CCO |
| InChI | InChI=1S/C9H16O/c1-4-5-8(2)9(3)6-7-10/h4-5,9-10H,1,6-7H2,2-3H3/b8-5+/t9-/m1/s1 |
| InChIKey | IGCPZASQRFQAGY-WHXYTISESA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|