C15H18F4N2O — CID 88900217
N-[4-[(2-amino-5-fluorophenyl)methyl]cyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 88900217) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is N-[4-[(2-amino-5-fluorophenyl)methyl]cyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(2-amino-5-fluorophenyl)methyl]cyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88900217 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[4-[(2-amino-5-fluorophenyl)methyl]cyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ccc(F)cc1CC1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18F4N2O/c16-11-3-6-13(20)10(8-11)7-9-1-4-12(5-2-9)21-14(22)15(17,18)19/h3,6,8-9,12H,1-2,4-5,7,20H2,(H,21,22) |
| InChIKey | WYJMXRZUDOFRHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|