C30H26FIN2O3 — CID 88900782
2-(4-fluorophenyl)-5-[3-[[(2E,4Z)-6-iodo-2-methylhexa-2,4-dienyl]carbamoyl]phenyl]-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 88900782) has the molecular formula C30H26FIN2O3 and a molecular weight of 608.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[3-[[(2E,4Z)-6-iodo-2-methylhexa-2,4-dienyl]carbamoyl]phenyl]-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[3-[[(2E,4Z)-6-iodo-2-methylhexa-2,4-dienyl]carbamoyl]phenyl]-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 88900782 |
| Molecular Formula | C30H26FIN2O3 |
| Molecular Weight | 608.45 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[3-[[(2E,4Z)-6-iodo-2-methylhexa-2,4-dienyl]carbamoyl]phenyl]-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cccc(C(=O)NC/C(C)=C/C=C\CI)c3)cc12 |
| InChI | InChI=1S/C30H26FIN2O3/c1-19(6-3-4-15-32)18-34-29(35)23-8-5-7-21(16-23)22-11-14-26-25(17-22)27(30(36)33-2)28(37-26)20-9-12-24(31)13-10-20/h3-14,16-17H,15,18H2,1-2H3,(H,33,36)(H,34,35)/b4-3-,19-6+ |
| InChIKey | PXHOAJYYZIVRPZ-IRBPDOHVSA-N |
| XLogP | 6.93 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|