C12H20N2O — CID 88900993
N-[(3Z,5E)-5-amino-2-methylidenehepta-3,5-dienyl]butanamide (PubChem CID 88900993) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N-[(3Z,5E)-5-amino-2-methylidenehepta-3,5-dienyl]butanamide.
| Compound Name | N-[(3Z,5E)-5-amino-2-methylidenehepta-3,5-dienyl]butanamide |
|---|---|
| PubChem CID | 88900993 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[(3Z,5E)-5-amino-2-methylidenehepta-3,5-dienyl]butanamide |
| SMILES | C=C(/C=C\C(N)=C/C)CNC(=O)CCC |
| InChI | InChI=1S/C12H20N2O/c1-4-6-12(15)14-9-10(3)7-8-11(13)5-2/h5,7-8H,3-4,6,9,13H2,1-2H3,(H,14,15)/b8-7-,11-5+ |
| InChIKey | NGACKTICLJDSHV-LTCQKBRTSA-N |
| XLogP | 1.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|