About (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine
(2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine (PubChem CID 88901116) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine |
| PubChem CID | 88901116 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine |
| SMILES | C=N/C(C)=C\C=C(\C)N |
| InChI | InChI=1S/C7H12N2/c1-6(8)4-5-7(2)9-3/h4-5H,3,8H2,1-2H3/b6-4-,7-5- |
| InChIKey | KMUVGLBZGWOUJM-PEPZGXQESA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine?
The IUPAC name of (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine (CID 88901116) is (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine?
The canonical SMILES for (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine is C=N/C(C)=C\C=C(\C)N.
What is the InChIKey of (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine?
The InChIKey is KMUVGLBZGWOUJM-PEPZGXQESA-N. The full InChI is InChI=1S/C7H12N2/c1-6(8)4-5-7(2)9-3/h4-5H,3,8H2,1-2H3/b6-4-,7-5-.
What are the key properties of (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine?
(2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine has a molecular weight of 124.19 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-5-(methylideneamino)hexa-2,4-dien-2-amine is sourced from PubChem (CID 88901116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).