About methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate
methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate (PubChem CID 88901212) has the molecular formula C16H26F3NO3
and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate.
Molecular Properties
| Compound Name | methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate |
| PubChem CID | 88901212 |
| Molecular Formula | C16H26F3NO3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate |
| SMILES | CCCCCCCC(C)/C=C/C(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C16H26F3NO3/c1-4-5-6-7-8-9-12(2)10-11-13(14(21)23-3)20-15(22)16(17,18)19/h10-13H,4-9H2,1-3H3,(H,20,22)/b11-10+ |
| InChIKey | NTPLQPMRDZHYLC-ZHACJKMWSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate?
The IUPAC name of methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate (CID 88901212) is methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate.
What is the SMILES notation for methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate?
The canonical SMILES for methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate is CCCCCCCC(C)/C=C/C(NC(=O)C(F)(F)F)C(=O)OC.
What is the InChIKey of methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate?
The InChIKey is NTPLQPMRDZHYLC-ZHACJKMWSA-N. The full InChI is InChI=1S/C16H26F3NO3/c1-4-5-6-7-8-9-12(2)10-11-13(14(21)23-3)20-15(22)16(17,18)19/h10-13H,4-9H2,1-3H3,(H,20,22)/b11-10+.
What are the key properties of methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate?
methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate has a molecular weight of 337.38 g/mol, XLogP of 3.76, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-5-methyl-2-[(2,2,2-trifluoroacetyl)amino]dodec-3-enoate is sourced from PubChem (CID 88901212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).