About 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene
3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene (PubChem CID 88901355) has the molecular formula C16H18O
and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene |
| PubChem CID | 88901355 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene |
| SMILES | C=C/C=C\C1=C(C)C(OC)c2ccccc2C1 |
| InChI | InChI=1S/C16H18O/c1-4-5-8-13-11-14-9-6-7-10-15(14)16(17-3)12(13)2/h4-10,16H,1,11H2,2-3H3/b8-5- |
| InChIKey | UVGJFHXMKOVKRF-YVMONPNESA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene (CID 88901355) is 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene is C=C/C=C\C1=C(C)C(OC)c2ccccc2C1.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene?
The InChIKey is UVGJFHXMKOVKRF-YVMONPNESA-N. The full InChI is InChI=1S/C16H18O/c1-4-5-8-13-11-14-9-6-7-10-15(14)16(17-3)12(13)2/h4-10,16H,1,11H2,2-3H3/b8-5-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene?
3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene has a molecular weight of 226.32 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-1-methoxy-2-methyl-1,4-dihydronaphthalene is sourced from PubChem (CID 88901355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).