About 1-methyl-2,3-dihydroindene-1-carbaldehyde
1-methyl-2,3-dihydroindene-1-carbaldehyde (PubChem CID 88901858) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-methyl-2,3-dihydroindene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-methyl-2,3-dihydroindene-1-carbaldehyde |
| PubChem CID | 88901858 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 1-methyl-2,3-dihydroindene-1-carbaldehyde |
| SMILES | CC1(C=O)CCc2ccccc21 |
| InChI | InChI=1S/C11H12O/c1-11(8-12)7-6-9-4-2-3-5-10(9)11/h2-5,8H,6-7H2,1H3 |
| InChIKey | IZEBRYSUNDNECT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,3-dihydroindene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dihydroindene-1-carbaldehyde?
The IUPAC name of 1-methyl-2,3-dihydroindene-1-carbaldehyde (CID 88901858) is 1-methyl-2,3-dihydroindene-1-carbaldehyde.
What is the SMILES notation for 1-methyl-2,3-dihydroindene-1-carbaldehyde?
The canonical SMILES for 1-methyl-2,3-dihydroindene-1-carbaldehyde is CC1(C=O)CCc2ccccc21.
What is the InChIKey of 1-methyl-2,3-dihydroindene-1-carbaldehyde?
The InChIKey is IZEBRYSUNDNECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-11(8-12)7-6-9-4-2-3-5-10(9)11/h2-5,8H,6-7H2,1H3.
What are the key properties of 1-methyl-2,3-dihydroindene-1-carbaldehyde?
1-methyl-2,3-dihydroindene-1-carbaldehyde has a molecular weight of 160.22 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydroindene-1-carbaldehyde is sourced from PubChem (CID 88901858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).