C10H14F6O3S — CID 88902019
2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 88902019) has the molecular formula C10H14F6O3S and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 88902019 |
| Molecular Formula | C10H14F6O3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(CC1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6O3S/c11-9(12,13)8(10(14,15)16,20(17,18)19)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,17,18,19) |
| InChIKey | HWOMGURVFIUVCI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|