C16H12F2O3S — CID 88902046
2-anthracen-1-yl-1,1-difluoroethanesulfonic acid (PubChem CID 88902046) has the molecular formula C16H12F2O3S and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-anthracen-1-yl-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-anthracen-1-yl-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 88902046 |
| Molecular Formula | C16H12F2O3S |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-anthracen-1-yl-1,1-difluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)Cc1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C16H12F2O3S/c17-16(18,22(19,20)21)10-14-7-3-6-13-8-11-4-1-2-5-12(11)9-15(13)14/h1-9H,10H2,(H,19,20,21) |
| InChIKey | ODZXWCGLZUGONN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|