C14H16F2O10S — CID 88902110
1,1-difluoro-2-oxo-2-(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl)oxyethanesulfonic acid (PubChem CID 88902110) has the molecular formula C14H16F2O10S and a molecular weight of 414.34 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 88902110 |
| Molecular Formula | C14H16F2O10S |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl)oxyethanesulfonic acid |
| SMILES | O=C1OC2C3OC4(CCCCC4)OC3OC2C1OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H16F2O10S/c15-14(16,27(19,20)21)12(18)24-8-6-7(22-10(8)17)9-11(23-6)26-13(25-9)4-2-1-3-5-13/h6-9,11H,1-5H2,(H,19,20,21) |
| InChIKey | QYJLPDYROUWUTM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|