About 2-amino-5-oxohexanedial
2-amino-5-oxohexanedial (PubChem CID 88902116) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-amino-5-oxohexanedial.
Molecular Properties
| Compound Name | 2-amino-5-oxohexanedial |
| PubChem CID | 88902116 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2-amino-5-oxohexanedial |
| SMILES | NC(C=O)CCC(=O)C=O |
| InChI | InChI=1S/C6H9NO3/c7-5(3-8)1-2-6(10)4-9/h3-5H,1-2,7H2 |
| InChIKey | OEISFZPNDUUUCF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-oxohexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-oxohexanedial?
The IUPAC name of 2-amino-5-oxohexanedial (CID 88902116) is 2-amino-5-oxohexanedial.
What is the SMILES notation for 2-amino-5-oxohexanedial?
The canonical SMILES for 2-amino-5-oxohexanedial is NC(C=O)CCC(=O)C=O.
What is the InChIKey of 2-amino-5-oxohexanedial?
The InChIKey is OEISFZPNDUUUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c7-5(3-8)1-2-6(10)4-9/h3-5H,1-2,7H2.
What are the key properties of 2-amino-5-oxohexanedial?
2-amino-5-oxohexanedial has a molecular weight of 143.14 g/mol, XLogP of -0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-oxohexanedial is sourced from PubChem (CID 88902116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).