C33H25N3 — CID 88902280
2-[2-(4,10-dimethylidene-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-methylanthracene-9,10-dicarbonitrile (PubChem CID 88902280) has the molecular formula C33H25N3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[2-(4,10-dimethylidene-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-methylanthracene-9,10-dicarbonitrile.
| Compound Name | 2-[2-(4,10-dimethylidene-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-methylanthracene-9,10-dicarbonitrile |
|---|---|
| PubChem CID | 88902280 |
| Molecular Formula | C33H25N3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[2-(4,10-dimethylidene-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-methylanthracene-9,10-dicarbonitrile |
| SMILES | C=C1CCN2CCC(=C)c3cc(C=Cc4ccc5c(C#N)c6cc(C)ccc6c(C#N)c5c4)cc1c32 |
| InChI | InChI=1S/C33H25N3/c1-20-4-8-25-29(14-20)31(18-34)26-9-7-23(15-30(26)32(25)19-35)5-6-24-16-27-21(2)10-12-36-13-11-22(3)28(17-24)33(27)36/h4-9,14-17H,2-3,10-13H2,1H3 |
| InChIKey | XPEKEKAZHQASNI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|