About 2-methoxy-N,3-dimethylbutanamide
2-methoxy-N,3-dimethylbutanamide (PubChem CID 88902446) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-methoxy-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-methoxy-N,3-dimethylbutanamide |
| PubChem CID | 88902446 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 2-methoxy-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(OC)C(C)C |
| InChI | InChI=1S/C7H15NO2/c1-5(2)6(10-4)7(9)8-3/h5-6H,1-4H3,(H,8,9) |
| InChIKey | VCTHVEWNIKUJCO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,3-dimethylbutanamide?
The IUPAC name of 2-methoxy-N,3-dimethylbutanamide (CID 88902446) is 2-methoxy-N,3-dimethylbutanamide.
What is the SMILES notation for 2-methoxy-N,3-dimethylbutanamide?
The canonical SMILES for 2-methoxy-N,3-dimethylbutanamide is CNC(=O)C(OC)C(C)C.
What is the InChIKey of 2-methoxy-N,3-dimethylbutanamide?
The InChIKey is VCTHVEWNIKUJCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-5(2)6(10-4)7(9)8-3/h5-6H,1-4H3,(H,8,9).
What are the key properties of 2-methoxy-N,3-dimethylbutanamide?
2-methoxy-N,3-dimethylbutanamide has a molecular weight of 145.20 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,3-dimethylbutanamide is sourced from PubChem (CID 88902446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).