C24H25N7O3S — CID 88902536
5-[4-morpholin-4-yl-6-[[4-(prop-2-enoxyamino)phenoxy]methyl]thieno[3,2-d]pyrimidin-2-yl]pyrimidin-2-amine (PubChem CID 88902536) has the molecular formula C24H25N7O3S and a molecular weight of 491.58 g/mol. Its IUPAC name is 5-[4-morpholin-4-yl-6-[[4-(prop-2-enoxyamino)phenoxy]methyl]thieno[3,2-d]pyrimidin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[4-morpholin-4-yl-6-[[4-(prop-2-enoxyamino)phenoxy]methyl]thieno[3,2-d]pyrimidin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 88902536 |
| Molecular Formula | C24H25N7O3S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 5-[4-morpholin-4-yl-6-[[4-(prop-2-enoxyamino)phenoxy]methyl]thieno[3,2-d]pyrimidin-2-yl]pyrimidin-2-amine |
| SMILES | C=CCONc1ccc(OCc2cc3nc(-c4cnc(N)nc4)nc(N4CCOCC4)c3s2)cc1 |
| InChI | InChI=1S/C24H25N7O3S/c1-2-9-34-30-17-3-5-18(6-4-17)33-15-19-12-20-21(35-19)23(31-7-10-32-11-8-31)29-22(28-20)16-13-26-24(25)27-14-16/h2-6,12-14,30H,1,7-11,15H2,(H2,25,26,27) |
| InChIKey | KCIIPBMKZNGHDS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|